| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:56 UTC |
|---|
| Update Date | 2025-03-25 00:59:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237703 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H9O11P |
|---|
| Molecular Mass | 299.9882 |
|---|
| SMILES | O=C1C(=O)C(O)(C(=O)O)OC1C(O)COP(=O)(O)O |
|---|
| InChI Key | UKXMZRUISUCNIA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acyloinsalpha hydroxy acids and derivativescarboxylic acidscyclic ketonesfuranoneshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidcyclic ketonecarboxylic acid derivativeketoneorganic oxidealiphatic heteromonocyclic compoundhemiacetalorganoheterocyclic compoundalcoholtetrahydrofuranhydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphateacyloinsecondary alcoholhydrocarbon derivative3-furanoneorganooxygen compound |
|---|
