| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:57 UTC |
|---|
| Update Date | 2025-03-25 00:59:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237737 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12N6S |
|---|
| Molecular Mass | 284.0844 |
|---|
| SMILES | Nc1nc(N)c2nc(SCc3ccccc3)cnc2n1 |
|---|
| InChI Key | LPGRUESTOQHNCP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkylarylthioethersazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminespyrazinespyrimidines and pyrimidine derivativessulfenyl compounds |
|---|
| Substituents | monocyclic benzene moietysulfenyl compoundazacycleheteroaromatic compoundalkylarylthioetherorganosulfur compoundpteridinearyl thioetherpyrimidinearomatic heteropolycyclic compoundthioetherpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundimidolactamamine |
|---|
