| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:58 UTC |
|---|
| Update Date | 2025-03-25 00:59:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237748 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H6N4O4S |
|---|
| Molecular Mass | 206.011 |
|---|
| SMILES | Nc1nc(O)nc(N)c1S(=O)(=O)O |
|---|
| InChI Key | NNANXJIDYTYZPT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | arylsulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidolactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsorganosulfonic acidsprimary aminessulfonyls |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compoundorganosulfonic acidhydroxypyrimidineorganosulfur compoundpyrimidineorganic oxidesulfonylarylsulfonic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamineorganoheterocyclic compoundorganooxygen compound |
|---|
