| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:00 UTC |
|---|
| Update Date | 2025-03-25 00:59:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237820 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13Cl3N5O6P |
|---|
| Molecular Mass | 446.9669 |
|---|
| SMILES | Nc1nc2c(ncn2C2CC(O)C(COP(=O)(O)C(Cl)(Cl)Cl)O2)c(=O)[nH]1 |
|---|
| InChI Key | OEALNYPIGLOHFR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl chloridesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganochloridesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsphosphonic acid estersprimary aminespurines and purine derivativespyrimidonessecondary alcoholstetrahydrofuranstrihalomethanesvinylogous amides |
|---|
| Substituents | lactamalkyl chlorideorganochloridemonosaccharidepyrimidoneorganohalogen compoundpyrimidinephosphonic acid estersaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundalkyl halideorganophosphonic acid derivativeazolen-substituted imidazolealcoholhalomethanevinylogous amidetrihalomethaneazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
