| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:01 UTC |
|---|
| Update Date | 2025-03-25 00:59:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237859 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14O7S |
|---|
| Molecular Mass | 254.046 |
|---|
| SMILES | O=C(O)CC1(O)OC(CO)C(O)C(O)C1S |
|---|
| InChI Key | QCHGCGQQBWVXNV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkylthiolscarbonyl compoundscarboxylic acidsfatty acylshemiacetalshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganosulfur compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholsthia fatty acids |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidmonosaccharideorganosulfur compoundcarboxylic acid derivativesaccharideorganic oxidealiphatic heteromonocyclic compoundhemiacetalhydroxy fatty acidoxaneprimary alcoholorganoheterocyclic compoundalcoholoxacyclemonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundsecondary alcoholhydrocarbon derivativesaccharolipidalkylthiolorganooxygen compound |
|---|
