| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:01 UTC |
|---|
| Update Date | 2025-03-25 00:59:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237868 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H22O11S |
|---|
| Molecular Mass | 386.0883 |
|---|
| SMILES | O=C(O)CC1(O)C(SC2OC(CO)C(O)C(O)C2O)OC(CO)C1O |
|---|
| InChI Key | YPPFCNSERMTEHP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | hydroxy fatty acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsfatty acylshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesmonothioacetalsorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssulfenyl compoundstertiary alcoholstetrahydrofuransthia fatty acids |
|---|
| Substituents | carbonyl groupcarboxylic acidmonosaccharideorganosulfur compoundcarboxylic acid derivativemonothioacetalsaccharideorganic oxidealiphatic heteromonocyclic compoundhydroxy fatty acidoxaneprimary alcoholorganoheterocyclic compoundalcoholsulfenyl compoundtetrahydrofuranoxacycletertiary alcoholmonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|