| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:04 UTC |
|---|
| Update Date | 2025-03-25 00:59:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237985 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O7 |
|---|
| Molecular Mass | 206.0427 |
|---|
| SMILES | O=C(O)CC1OC(=O)C(C(O)CO)O1 |
|---|
| InChI Key | YPTKCRISBCPUSI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | dicarboxylic acids and derivatives |
|---|
| Direct Parent | dicarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,3-dioxolanesacetalscarbonyl compoundscarboxylic acid esterscarboxylic acidshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholmeta-dioxolanecarbonyl groupcarboxylic acidlactoneoxacycleorganic oxideorganic oxygen compoundacetalcarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeprimary alcoholorganoheterocyclic compoundorganooxygen compound1,2-diol |
|---|
