| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:07 UTC |
|---|
| Update Date | 2025-03-25 00:59:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238094 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O7 |
|---|
| Molecular Mass | 206.0427 |
|---|
| SMILES | O=C(O)CC(CCOC(=O)O)C(=O)O |
|---|
| InChI Key | DUMADMXWPILKAC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | branched fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonic acid monoesterscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesshort-chain hydroxy acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarbonic acid derivativecarboxylic acidshort-chain hydroxy acidcarboxylic acid derivativebranched fatty acidorganic oxidecarbonic acid monoesterorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|