| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:12 UTC |
|---|
| Update Date | 2025-03-25 00:59:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238292 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18FNO2 |
|---|
| Molecular Mass | 251.1322 |
|---|
| SMILES | O=C(O)CCCC1(c2ccc(F)cc2)CCCN1 |
|---|
| InChI Key | VVMZYSXCNBTYLJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | delta amino acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidsaryl fluoridesazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylaminesfluorobenzeneshalogenated fatty acidsheterocyclic fatty acidshydrocarbon derivativesmedium-chain fatty acidsmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganopnictogen compoundsphenylpyrrolidinespyrroles |
|---|
| Substituents | aryl fluoridefatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acidheterocyclic fatty acidfatty acidorganohalogen compoundfluorobenzeneorganic oxideorganonitrogen compoundorganopnictogen compounddelta amino acid or derivativesmedium-chain fatty acidpyrrolidineorganoheterocyclic compoundhalogenated fatty acidsecondary aliphatic amineazacycleorganofluoride2-phenylpyrrolidinesecondary aminearyl halidemonocarboxylic acid or derivativesorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compoundamine |
|---|