| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:14 UTC |
|---|
| Update Date | 2025-03-25 00:59:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238365 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14O10 |
|---|
| Molecular Mass | 294.0587 |
|---|
| SMILES | O=C(O)C1=C(O)C(O)C(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | SREODBSFXXPXKB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesoxacyclic compoundsprimary alcoholssecondary alcoholsvinylogous acids |
|---|
| Substituents | alcoholcarbonyl groupethercarboxylic acidpyran carboxylic acid or derivativeshydroxy acidcarboxylic acid derivativedialkyl etheroxacyclevinylogous acidbeta-hydroxy acidorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeprimary alcoholorganooxygen compound |
|---|