| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:17 UTC |
|---|
| Update Date | 2025-03-25 00:59:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238486 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H6O8S |
|---|
| Molecular Mass | 201.9783 |
|---|
| SMILES | O=C(O)C(O)C(O)(O)S(=O)(=O)O |
|---|
| InChI Key | ZIXQIICPNWAVID-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | alpha hydroxy acids and derivatives |
|---|
| Direct Parent | alpha hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganosulfonic acidssecondary alcoholssulfonyls |
|---|
| Substituents | alcoholaliphatic acyclic compoundorganosulfonic acid or derivativescarbonyl groupcarboxylic acidalpha-hydroxy acidorganosulfonic acidmonosaccharideorganosulfur compoundcarboxylic acid derivativesaccharideorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativessecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|