| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:18 UTC |
|---|
| Update Date | 2025-03-25 00:59:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238498 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H22O11 |
|---|
| Molecular Mass | 354.1162 |
|---|
| SMILES | O=C(O)C1(O)CC(O)OC(OCC2C(O)C(O)C(O)C(O)C2O)C1 |
|---|
| InChI Key | FOVASNIIQRYGDA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativeshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanestertiary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidcyclohexanolcyclitol or derivativeshydroxy acidcyclic alcoholcarboxylic acid derivativeoxacycletertiary alcoholorganic oxidemonocarboxylic acid or derivativesacetalaliphatic heteromonocyclic compoundhemiacetalhydrocarbon derivativeoxaneorganoheterocyclic compound |
|---|
