| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:18 UTC |
|---|
| Update Date | 2025-03-25 00:59:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238511 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H18O8 |
|---|
| Molecular Mass | 266.1002 |
|---|
| SMILES | O=C(O)C1(O)CC(O)C(OCC(O)CO)C(O)C1 |
|---|
| InChI Key | AFTKGBYDQIEWER-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclohexanolsdialkyl ethersglycerol ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesprimary alcoholstertiary alcohols |
|---|
| Substituents | carbonyl groupethercarboxylic acidalpha-hydroxy acidcyclohexanolhydroxy acidcarboxylic acid derivativedialkyl ethertertiary alcoholorganic oxidemonocarboxylic acid or derivativesglycerolipidsecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativeprimary alcoholglycerol etherquinic acid |
|---|
