| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:18 UTC |
|---|
| Update Date | 2025-03-25 00:59:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238514 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H12O8S2 |
|---|
| Molecular Mass | 287.9974 |
|---|
| SMILES | O=C(O)C1(O)CC(O)C(O)C(SS(=O)(=O)O)C1 |
|---|
| InChI Key | MAAIDGLFJYBZBT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclohexanolshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidess-alkyl thiosulfatessulfenyl compoundstertiary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidsulfenyl compoundalpha-hydroxy acidcyclohexanolhydroxy acidorganosulfur compoundcarboxylic acid derivatives-alkyl thiosulfatetertiary alcoholorganic oxidemonocarboxylic acid or derivativessecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativequinic acid |
|---|