| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:18 UTC |
|---|
| Update Date | 2025-03-25 00:59:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238524 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14O4 |
|---|
| Molecular Mass | 198.0892 |
|---|
| SMILES | O=C(O)C1(O)CCC2(C=CCO2)CC1 |
|---|
| InChI Key | FEUZKFLPFBQDSR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | alpha hydroxy acids and derivatives |
|---|
| Direct Parent | alpha hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidscyclic alcohols and derivativesdialkyl ethersdihydrofuranshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupethercarboxylic acidalpha-hydroxy acidcyclic alcoholcarboxylic acid derivativedialkyl etheroxacycletertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaliphatic heteromonocyclic compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compounddihydrofuran |
|---|