| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:20 UTC |
|---|
| Update Date | 2025-03-25 00:59:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238586 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H21NO9 |
|---|
| Molecular Mass | 419.1216 |
|---|
| SMILES | O=C(O)C1OC(OC2Oc3ccccc3N(O)C2c2ccccc2)C(O)C(O)C1O |
|---|
| InChI Key | YNFUKVLAGQCUMG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxylamino, 2-unsubstituted benzenoids1-hydroxylamino, 4-unsubstituted benzenoidsacetalsazacyclic compoundsbenzene and substituted derivativesbenzomorpholinesbenzoxazinesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesn-organohydroxylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acido-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidbenzomorpholine1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1-hydroxylamino, 2-unsubstituted benzenoidoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesazacyclebenzoxazinehydroxy acidn-organohydroxylamineoxazinaneoxacyclemorpholinemonocarboxylic acid or derivativespyransecondary alcohol1-hydroxylamino, 4-unsubstituted benzenoidhydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|
