| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:24 UTC |
|---|
| Update Date | 2025-03-25 00:59:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238735 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H19NO7 |
|---|
| Molecular Mass | 289.1162 |
|---|
| SMILES | O=C(O)CNC(CCC1CCC(CC(=O)O)O1)C(=O)O |
|---|
| InChI Key | NJZOIJCLBHYAMC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidscarbonyl compoundscarboxylic acidsdialkyl ethersdialkylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundstetrahydrofuranstricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupethercarboxylic acidamino acidtricarboxylic acid or derivativesdialkyl etherorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundsecondary aliphatic aminetetrahydrofuransecondary amineoxacycleorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
