| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:25 UTC |
|---|
| Update Date | 2025-03-25 00:59:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238762 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15ClN2O3S |
|---|
| Molecular Mass | 302.0492 |
|---|
| SMILES | NC(=O)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
|---|
| InChI Key | ACOOMXCDQHIKGS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundsbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshydrocarbon derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamidespiperidinecarboxamidespiperidinesprimary carboxylic acid amidessulfonyls |
|---|
| Substituents | primary carboxylic acid amideorganosulfonic acid or derivativescarbonyl grouparomatic heteromonocyclic compoundorganochlorideorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidineorganoheterocyclic compoundbenzenesulfonyl grouparyl chloridechlorobenzenebenzenesulfonamideazacyclepiperidinecarboxamidecarboxamide grouparyl halidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
