| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:28 UTC |
|---|
| Update Date | 2025-03-25 00:59:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238870 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H11NO5 |
|---|
| Molecular Mass | 297.0637 |
|---|
| SMILES | O=CNc1cc2c(=O)c(-c3ccc(O)cc3)coc2cc1O |
|---|
| InChI Key | DYIAXJFNCQQYPM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsn-arylamidesorganic oxidesorganopnictogen compoundsoxacyclic compoundspyranones and derivativessecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl group1-benzopyran1-hydroxy-2-unsubstituted benzenoidn-arylamidecarboxylic acid derivativeorganic oxidechromonearomatic heteropolycyclic compoundorganonitrogen compoundpyranoneorganopnictogen compoundorganoheterocyclic compoundisoflavonebenzopyranheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundpyranphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|