| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:28 UTC |
|---|
| Update Date | 2025-03-25 00:59:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238879 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8N2O6S |
|---|
| Molecular Mass | 260.0103 |
|---|
| SMILES | O=CNc1ccc(C(=O)O)cc1NS(=O)(=O)O |
|---|
| InChI Key | KAQKYQKWEDTXOI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | acylaminobenzoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | anilidesbenzoic acidsbenzoyl derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-arylamidesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidessulfanilidessulfuric acid monoamides |
|---|
| Substituents | carbonyl groupcarboxylic acidbenzoyln-arylamidecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundbenzoic acidacylaminobenzoic acid or derivativesorganic sulfuric acid or derivativescarboxamide grouparomatic homomonocyclic compoundsulfanilideanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsulfuric acid monoamidehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|