| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:30 UTC |
|---|
| Update Date | 2025-03-25 00:59:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238964 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10N4O2 |
|---|
| Molecular Mass | 218.0804 |
|---|
| SMILES | NC(=O)c1ncn(-c2ccccc2O)c1N |
|---|
| InChI Key | RAVPWZVHVLTDDG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azoles |
|---|
| Subclass | imidazoles |
|---|
| Direct Parent | phenylimidazoles |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-heteroaryl carboxamidesamino acids and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarbonylimidazolescarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesn-substituted imidazolesorganic oxidesorganopnictogen compoundsprimary aminesprimary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupmonocyclic benzene moietyaromatic heteromonocyclic compoundamino acid or derivatives1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivative2-heteroaryl carboxamide1-phenylimidazoleorganic oxideorganonitrogen compoundorganopnictogen compoundimidazole-4-carbonyl groupn-substituted imidazolevinylogous amideazacycleheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidcarboxamide grouporganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|