| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:31 UTC |
|---|
| Update Date | 2025-03-25 00:59:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238980 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13NO4 |
|---|
| Molecular Mass | 223.0845 |
|---|
| SMILES | NC(=O)c1cccc(CC(CO)C(=O)O)c1 |
|---|
| InChI Key | MKVPAIYZFYRNQH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzamidesbenzoyl derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidemonocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidbenzoylcarboxylic acid derivativebenzamidebeta-hydroxy acidorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholbenzoic acid or derivativeshydroxy acidcarboxamide grouparomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
