| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:31 UTC |
|---|
| Update Date | 2025-03-25 00:59:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02238994 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N5O7P |
|---|
| Molecular Mass | 359.0631 |
|---|
| SMILES | NC(=O)c1cnc2ncn(C3CC(O)C(COP(=O)(O)O)O3)c2n1 |
|---|
| InChI Key | LMRBLXVRXODCLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesimidazopyrazinesmonoalkyl phosphatesmonosaccharidesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary carboxylic acid amidespyrazinecarboxamidessecondary alcoholstetrahydrofurans |
|---|
| Substituents | primary carboxylic acid amideimidazopyrazinepentose phosphatecarboxylic acid derivative2-heteroaryl carboxamideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazolen-substituted imidazolealcoholpyrazinecarboxamideazacycletetrahydrofuranheteroaromatic compoundcarboxamide groupoxacyclephosphoric acid esterpyrazinemonoalkyl phosphatesecondary alcoholpyrazine carboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|