| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:33 UTC |
|---|
| Update Date | 2025-03-25 00:59:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239058 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10FNO3 |
|---|
| Molecular Mass | 211.0645 |
|---|
| SMILES | NC(CC(=O)C(=O)O)c1ccc(F)cc1 |
|---|
| InChI Key | QTRMRWVPJZSCNF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | gamma amino acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesaryl fluoridescarboxylic acidsfluorobenzeneshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | aryl fluoridemonocyclic benzene moietycarbonyl groupcarboxylic acidgamma amino acid or derivativesalpha-hydroxy ketoneorganohalogen compoundketonefluorobenzeneorganic oxideorganonitrogen compoundalpha-keto acidorganopnictogen compoundorganofluoridearyl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundketo acidhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
