| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:34 UTC |
|---|
| Update Date | 2025-03-25 00:59:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239115 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14NO10P |
|---|
| Molecular Mass | 315.0355 |
|---|
| SMILES | O=CC(O)C(O)COP(=O)(O)OCC(=O)NCC(=O)O |
|---|
| InChI Key | DUYIODZJDBRAIY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha amino acidsalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acidsdialkyl phosphateshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | aliphatic acyclic compoundbeta-hydroxy aldehydecarbonyl groupcarboxylic acidmonosaccharidephosphoethanolaminesaccharideorganic oxidealpha-hydroxyaldehydeorganonitrogen compoundalpha-amino acidorganopnictogen compound1,2-diolalcoholaldehydecarboxamide groupn-acylglycinesecondary carboxylic acid amidedialkyl phosphatemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
