| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:35 UTC |
|---|
| Update Date | 2025-03-25 00:59:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239120 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H9FN2O2 |
|---|
| Molecular Mass | 232.0648 |
|---|
| SMILES | NC(=O)c1ccc(Oc2ccc(F)cc2)nc1 |
|---|
| InChI Key | FWHOOKXNDGYVOI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | diarylethers |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaryl fluoridesazacyclic compoundscarboxylic acids and derivativesfluorobenzenesheteroaromatic compoundshydrocarbon derivativesnicotinamidesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundspolyhalopyridinesprimary carboxylic acid amidespyridinecarboxylic acids and derivatives |
|---|
| Substituents | aryl fluorideprimary carboxylic acid amidediaryl etherpyridine carboxylic acid or derivativesphenol ethermonocyclic benzene moietyaromatic heteromonocyclic compoundpolyhalopyridinenicotinamidecarboxylic acid derivativeorganohalogen compoundfluorobenzeneorganic oxideorganonitrogen compoundorganopnictogen compound2-halopyridineorganoheterocyclic compoundazacycleorganofluorideheteroaromatic compoundcarboxamide grouparyl halidepyridinehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzenephenoxy compound |
|---|
