| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:35 UTC |
|---|
| Update Date | 2025-03-25 00:59:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239122 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16ClN7O2 |
|---|
| Molecular Mass | 349.1054 |
|---|
| SMILES | NC(=O)c1ccc(NCC2CNc3[nH]c(N)nc(=O)c3N2)cc1Cl |
|---|
| InChI Key | XCVCSXYBKRJGFA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halobenzoic acids and derivativesamino acids and derivativesaryl chloridesazacyclic compoundsbenzamidesbenzoyl derivativescarboxylic acids and derivativeschlorobenzenesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganochloridesorganooxygen compoundsorganopnictogen compoundsphenylalkylaminesprimary aminesprimary carboxylic acid amidespyrimidonessecondary alkylarylaminesvinylogous amidesvinylogous halides |
|---|
| Substituents | primary carboxylic acid amidemonocyclic benzene moietyamino acid or derivativesorganochloridebenzoylpyrimidonecarboxylic acid derivativeorganohalogen compoundbenzamidepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundaryl chloridechlorobenzenevinylogous amidepterinazacycleheteroaromatic compoundbenzoic acid or derivativeshalobenzoic acid or derivativessecondary aminecarboxamide groupvinylogous halide2-halobenzoic acid or derivativessecondary aliphatic/aromatic aminearyl halideorganic oxygen compoundphenylalkylaminehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|