| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:36 UTC |
|---|
| Update Date | 2025-03-25 00:59:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239189 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H14O12P2 |
|---|
| Molecular Mass | 327.996 |
|---|
| SMILES | O=P(O)(O)O[PH](=O)(O)(O)OCC1OC(O)C(O)C1O |
|---|
| InChI Key | LDAZXUPBAOUBMW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolshemiacetalshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganic phosphoric acids and derivativesoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholtetrahydrofuranpentose phosphatepentose-5-phosphateoxacycleorganic oxidemonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholhemiacetalhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganoheterocyclic compound1,2-diol |
|---|
