| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:37 UTC |
|---|
| Update Date | 2025-03-25 00:59:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239222 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15O9P |
|---|
| Molecular Mass | 334.0454 |
|---|
| SMILES | O=P1(O)OCC2OC(c3ccc(O)c(O)c3)C(O)C(O)C2O1 |
|---|
| InChI Key | FNAGTNZTHCZMNC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesdialkyl ethershydrocarbon derivativesmonosaccharidesorganic oxidesorganic phosphoric acids and derivativesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyether1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoiddialkyl etheroxacycleorganic oxidearomatic heteropolycyclic compoundsecondary alcoholhexose phosphatephenolhydrocarbon derivativebenzenoidoxaneorganic phosphoric acid derivativeorganoheterocyclic compound1,2-diol |
|---|
