| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:41 UTC |
|---|
| Update Date | 2025-03-25 00:59:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239359 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17NO3S2 |
|---|
| Molecular Mass | 275.065 |
|---|
| SMILES | O=S(=O)(O)CCNCCSCc1ccccc1 |
|---|
| InChI Key | ZXAGWYHSYXMQQA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | dialkylaminesdialkylthioethershydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonic acidssulfenyl compoundssulfonyls |
|---|
| Substituents | secondary aliphatic amineorganosulfonic acid or derivativesmonocyclic benzene moietysulfenyl compounddialkylthioetherorganosulfonic acidsecondary amineorganosulfur compoundaromatic homomonocyclic compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesthioetherorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundamine |
|---|