| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:42 UTC |
|---|
| Update Date | 2025-03-25 00:59:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239396 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H11NO11S2 |
|---|
| Molecular Mass | 324.9774 |
|---|
| SMILES | O=S(=O)(O)NC1(O)OC(COS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | UBFBAZJDLPVCQT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkanolaminesalkyl sulfateshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorthocarboxylic acid derivativesoxacyclic compoundssecondary alcoholssulfuric acid monoamidestetrahydrofurans |
|---|
| Substituents | sulfuric acid monoestermonosaccharidesaccharideorganic oxidealkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorthocarboxylic acid derivativeorganoheterocyclic compoundalkanolamine1,2-diolalcoholtetrahydrofuranoxacycleorganic oxygen compoundsulfuric acid monoamidesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
