| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:42 UTC |
|---|
| Update Date | 2025-03-25 00:59:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239397 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10F3N5S |
|---|
| Molecular Mass | 277.0609 |
|---|
| SMILES | Cn1c(SCCC(F)(F)F)nc2ncnc(N)c21 |
|---|
| InChI Key | PLUVZFZCFRLFOK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalkylarylthioethersazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganofluoridesorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivativessulfenyl compounds |
|---|
| Substituents | alkylarylthioetherorganosulfur compoundorganohalogen compoundaryl thioetherpyrimidinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundalkyl halideimidolactamazolen-substituted imidazolesulfenyl compoundazacyclealkyl fluorideorganofluorideheteroaromatic compoundthioetherhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamine |
|---|