| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:42 UTC |
|---|
| Update Date | 2025-03-25 00:59:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239403 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H23NO21S4 |
|---|
| Molecular Mass | 644.9645 |
|---|
| SMILES | O=S(=O)(O)NC1C(O)CC(OS(=O)(=O)O)C(OC2C(COS(=O)(=O)O)OC(O)C(O)C2OS(=O)(=O)O)C1O |
|---|
| InChI Key | FPKALBQRXNNJGM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | sulfamic acid derivatives |
|---|
| Subclass | cyclamates |
|---|
| Direct Parent | cyclamates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatescyclitols and derivativescyclohexanolsdialkyl ethershemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessulfuric acid monoamidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterethermonosaccharidedialkyl ethersaccharideorganic oxidealkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundalcoholorganic sulfuric acid or derivativescyclohexanolcyclamic_acid_derivativecyclitol or derivativescyclic alcoholoxacycleorganic oxygen compoundsulfuric acid monoamidesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|
