| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:43 UTC |
|---|
| Update Date | 2025-03-25 00:59:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239425 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10N3O3PS |
|---|
| Molecular Mass | 247.018 |
|---|
| SMILES | N=C(N)Nc1ccc(OP(O)(O)=S)cc1 |
|---|
| InChI Key | IXOOFTUASFDFTH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic thiophosphoric acids and derivatives |
|---|
| Subclass | thiophosphoric acid esters |
|---|
| Direct Parent | phenyl thiophosphates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carboximidamidesguanidineshydrocarbon derivativesiminesorganooxygen compoundsorganopnictogen compoundsphenoxy compoundsthiophosphate monoesters |
|---|
| Substituents | monocyclic benzene moietyguanidineiminecarboximidamidephenyl thiophosphatethiophosphate monoesteraromatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
