| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:43 UTC |
|---|
| Update Date | 2025-03-25 00:59:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239447 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H5NO6S |
|---|
| Molecular Mass | 218.9838 |
|---|
| SMILES | O=NOS(=O)(=O)Oc1ccc(O)cc1 |
|---|
| InChI Key | GWFVRBOQKYGYPT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidshydrocarbon derivativesorganic o-nitroso compoundsorganic nitritesorganic nitrogen compoundsorganic oxidesorganooxygen compoundsphenoxy compounds |
|---|
| Substituents | monocyclic benzene moietyorganic nitroso compound1-hydroxy-2-unsubstituted benzenoidorganic nitritearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundphenolhydrocarbon derivativearylsulfatebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compoundorganic o-nitroso compound |
|---|
