| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:45 UTC |
|---|
| Update Date | 2025-03-25 00:59:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239525 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H20N8O2 |
|---|
| Molecular Mass | 260.1709 |
|---|
| SMILES | N=C(NCCCC(N)C(=O)O)NC(=N)NC(N)N |
|---|
| InChI Key | TYXBKIQSKLSTLD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | arginine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsbiguanidescarbonyl compoundscarboximidamidescarboxylic acidsfatty acids and conjugateshydrocarbon derivativesiminesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsortho amidesorthocarboxylic acid derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidortho amideguanidineiminefatty acidcarboximidamideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundarginine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundbiguanideorthocarboxylic acid derivativeorganooxygen compound |
|---|
