| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:50 UTC |
|---|
| Update Date | 2025-03-25 00:59:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239704 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18N2O9 |
|---|
| Molecular Mass | 382.1012 |
|---|
| SMILES | O=C1NC(=O)C(Cc2ccc(OC3C(O)OC(C(=O)O)C(O)C3O)cc2)N1 |
|---|
| InChI Key | LNMUASCMWAEAHG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl aryl ethersalpha amino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboximideshemiacetalshydantoinshydrocarbon derivativesimidazolidinonesmonocarboxylic acids and derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | imidazolidinephenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compoundmonosaccharidealpha-amino acid or derivativesalkyl aryl ethercarboxylic acid derivativepyran carboxylic acidimidazolidinonebeta-hydroxy acidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundhemiacetaldicarboximideoxaneorganoheterocyclic compound1,2-diolalcoholcarbonic acid derivativepyran carboxylic acid or derivativesazacyclehydroxy acidoxacyclemonocarboxylic acid or derivativeshydantoinpyransecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compound |
|---|
