| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:55 UTC |
|---|
| Update Date | 2025-03-25 00:59:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239914 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H4F17NO3S |
|---|
| Molecular Mass | 528.964 |
|---|
| SMILES | NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)(F)C(O)(F)F |
|---|
| InChI Key | FSKDDBQXDYOIBJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organic sulfonamides |
|---|
| Direct Parent | organic sulfonamides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkyl fluoridesaminosulfonyl compoundsfluorohydrinshydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganofluoridesorganosulfonamides |
|---|
| Substituents | alcoholaliphatic acyclic compoundorganosulfonic acid or derivativesaminosulfonyl compoundhalohydrinalkyl fluorideorganofluoridefluorohydrinorganosulfur compoundorganohalogen compoundorganosulfonic acid amideorganic oxidesulfonylorganic oxygen compoundalkyl halidehydrocarbon derivativeorganic nitrogen compoundorganic sulfonic acid amideorganooxygen compound |
|---|