| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:55 UTC |
|---|
| Update Date | 2025-03-25 00:59:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239915 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H7F8NO2S |
|---|
| Molecular Mass | 357.007 |
|---|
| SMILES | NS(=O)(=O)C(F)(F)C(F)(F)C(F)(c1ccccc1)C(F)(F)F |
|---|
| InChI Key | BJBLHMRVDCBSRD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesaminosulfonyl compoundshydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganic sulfonamidesorganofluoridesorganosulfonamides |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietyaminosulfonyl compoundalkyl fluorideorganofluorideorganosulfur compoundorganohalogen compoundorganosulfonic acid amidearomatic homomonocyclic compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesalkyl halidehydrocarbon derivativeorganic nitrogen compoundorganic sulfonic acid amide |
|---|
