| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:56 UTC |
|---|
| Update Date | 2025-03-25 00:59:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239948 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H14O7 |
|---|
| Molecular Mass | 294.074 |
|---|
| SMILES | O=C1CCC(Cc2cccc(OC(C(=O)O)C(=O)O)c2)O1 |
|---|
| InChI Key | OTJJSYVLPCTCHH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxyacetic acid derivatives |
|---|
| Direct Parent | phenoxyacetic acid derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsalkyl aryl etherscarboxylic acid esterscarboxylic acidsgamma butyrolactoneshydrocarbon derivativesorganic oxidesoxacyclic compoundsphenol ethersphenoxy compoundstetrahydrofuranstricarboxylic acids and derivatives |
|---|
| Substituents | phenol etherphenoxyacetatecarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundtetrahydrofurantricarboxylic acid or derivativesalkyl aryl ethercarboxylic acid derivativegamma butyrolactonelactoneoxacycleorganic oxideorganic oxygen compoundcarboxylic acid esterhydrocarbon derivative1,3-dicarbonyl compoundphenoxy compoundorganoheterocyclic compoundorganooxygen compound |
|---|