| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:16:57 UTC |
|---|
| Update Date | 2025-03-25 00:59:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02239966 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O3S |
|---|
| Molecular Mass | 222.0351 |
|---|
| SMILES | O=C1CSC(=O)C1Cc1cccc(O)c1 |
|---|
| InChI Key | UWUZCFRSGZPGSU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compounds1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarbothioic s-lactonescarboxylic acids and derivativescyclic ketoneshydrocarbon derivativesorganic oxidesthioestersthiolactonesthiolanes |
|---|
| Substituents | thiolanecarbothioic s-lactonemonocyclic benzene moietythiocarboxylic acid or derivativescarbonyl grouparomatic heteromonocyclic compoundthiocarboxylic acid ester1-hydroxy-2-unsubstituted benzenoidcyclic ketone1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativeketoneorganic oxideorganic oxygen compoundhydrocarbon derivative1,3-dicarbonyl compoundthiolactoneorganoheterocyclic compoundorganooxygen compound |
|---|
