| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:00 UTC |
|---|
| Update Date | 2025-03-25 00:59:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02240090 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H29N3O8 |
|---|
| Molecular Mass | 427.1955 |
|---|
| SMILES | NC(CCCCNc1ccc(C(=O)NC2C(O)OC(CO)C(O)C2O)cc1)C(=O)O |
|---|
| InChI Key | UJHUQYLODFESQB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsamino fatty acidsbenzamidesbenzoyl derivativescarbonyl compoundscarboxylic acidshemiacetalsheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsmedium-chain fatty acidsmedium-chain hydroxy acids and derivativesmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenylalkylaminesprimary alcoholssaccharolipidssecondary alcoholssecondary alkylarylaminessecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidamino acid or derivativesbenzoylmonosaccharidealpha-amino acid or derivativesmedium-chain hydroxy acidorganonitrogen compoundalpha-amino acidhemiacetalhydroxy fatty acidoxaneorganoheterocyclic compoundalcoholsecondary aliphatic/aromatic aminesecondary carboxylic acid amidehydrocarbon derivativeprimary aliphatic amineaminefatty acylcarbonyl grouparomatic heteromonocyclic compoundamino acidheterocyclic fatty acidfatty acidcarboxylic acid derivativebenzamiden-acyl-alpha-hexosamineorganic oxideorganopnictogen compoundmedium-chain fatty acidprimary alcoholbenzoic acid or derivativessecondary aminecarboxamide groupamino fatty acidacylaminosugaroxacyclemonocarboxylic acid or derivativessecondary alcoholphenylalkylaminebenzenoidorganic nitrogen compoundsaccharolipid |
|---|
