| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:02 UTC |
|---|
| Update Date | 2025-03-25 00:59:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02240174 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H8O4 |
|---|
| Molecular Mass | 276.0423 |
|---|
| SMILES | O=C1c2ccccc2C(=O)c2c1c(=O)oc1ccccc21 |
|---|
| InChI Key | RNUHVEZPISPQFW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isochromanequinones |
|---|
| Subclass | isochromanequinones |
|---|
| Direct Parent | isochromanequinones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransaryl ketonescoumarins and derivativesheteroaromatic compoundshydrocarbon derivativeslactonesnaphthalenesnaphthopyranonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativesquinones |
|---|
| Substituents | benzopyran1-benzopyranisochromanequinoneheteroaromatic compoundnaphthopyranonecoumarinketonelactoneoxacyclenaphthopyranorganic oxidenaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranoneisochromanehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compoundaryl ketonequinone |
|---|
