DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 15:17:05 UTC
Update Date	2025-03-25 00:59:57 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID02240290
Frequency	0.5
Structure
Chemical Formula	C₁₉H₂₅N₅O₈S
Molecular Mass	483.1424
SMILES	NC(CCC(=O)O)C(=O)NC(CSN=O)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)O
InChI Key	FPGQQLOBSIBHQF-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic polymers
Class	polypeptides
Subclass	polypeptides
Direct Parent	polypeptides
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	alpha amino acid amides alpha amino acids amphetamines and derivatives benzene and substituted derivatives carbonyl compounds carboxylic acids cysteine and derivatives dicarboxylic acids and derivatives glutamic acid and derivatives hydrocarbon derivatives monoalkylamines n-acyl amines n-acyl-alpha amino acids nitrosothiols organic oxides organopnictogen compounds peptides phenylalanine and derivatives phenylpropanoic acids secondary carboxylic acid amides sulfenyl compounds
Substituents	fatty acyl monocyclic benzene moiety carbonyl group carboxylic acid 3-phenylpropanoic-acid fatty amide alpha-amino acid or derivatives organosulfur compound carboxylic acid derivative alpha peptide nitrosothiol organic oxide organonitrogen compound alpha-amino acid organopnictogen compound amphetamine or derivatives organic s-nitroso compound n-acyl-alpha amino acid or derivatives polypeptide organic nitroso compound sulfenyl compound alpha-amino acid amide n-acyl-alpha-amino acid glutamic acid or derivatives carboxamide group n-acyl-amine n-substituted-alpha-amino acid aromatic homomonocyclic compound secondary carboxylic acid amide phenylalanine or derivatives organic oxygen compound cysteine or derivatives dicarboxylic acid or derivatives hydrocarbon derivative benzenoid primary aliphatic amine organic nitrogen compound organooxygen compound nitrosothiol-group

Showing information for DMID02240290