DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 15:17:08 UTC
Update Date	2025-03-25 00:59:58 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID02240421
Frequency	0.5
Structure
Chemical Formula	C₁₉H₂₁N₃O₅
Molecular Mass	371.1481
SMILES	NC(Cc1ccc(O)cc1)C(=O)NCCC(=O)Nc1ccc(C(=O)O)cc1
InChI Key	YGBXJORREDHPIV-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	peptidomimetics
Subclass	hybrid peptides
Direct Parent	hybrid peptides
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids acylaminobenzoic acid and derivatives alpha amino acid amides alpha amino acids amphetamines and derivatives anilides benzoic acids benzoyl derivatives beta amino acids and derivatives carbonyl compounds carboxylic acids fatty amides hydrocarbon derivatives monoalkylamines monocarboxylic acids and derivatives n-arylamides organic oxides organopnictogen compounds phenylalanine and derivatives secondary carboxylic acid amides tyrosine and derivatives
Substituents	fatty acyl monocyclic benzene moiety carbonyl group carboxylic acid fatty amide benzoyl 1-hydroxy-2-unsubstituted benzenoid n-arylamide alpha-amino acid or derivatives carboxylic acid derivative organic oxide organonitrogen compound alpha-amino acid organopnictogen compound benzoic acid amphetamine or derivatives acylaminobenzoic acid or derivatives tyrosine or derivatives alpha-amino acid amide benzoic acid or derivatives carboxamide group beta amino acid or derivatives aromatic homomonocyclic compound anilide secondary carboxylic acid amide monocarboxylic acid or derivatives phenylalanine or derivatives organic oxygen compound hybrid peptide phenol hydrocarbon derivative benzenoid primary aliphatic amine organic nitrogen compound organooxygen compound

Showing information for DMID02240421