| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:12 UTC |
|---|
| Update Date | 2025-03-25 01:00:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02240573 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H19NO2 |
|---|
| Molecular Mass | 329.1416 |
|---|
| SMILES | CC(C(=O)Nc1ccccc1)c1cccc(C(=O)c2ccccc2)c1 |
|---|
| InChI Key | HYKIQLBXJFFPKJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | anilidesaryl ketonesaryl-phenylketonesbenzoyl derivativescarboxylic acids and derivativesdiphenylmethaneshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundsphenylacetamidessecondary carboxylic acid amides |
|---|
| Substituents | diphenylmethanecarbonyl grouparyl-phenylketonebenzoyln-arylamidecarboxamide groupcarboxylic acid derivativebenzophenoneketonearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenylacetamideorganooxygen compoundaryl ketone |
|---|
