| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:12 UTC |
|---|
| Update Date | 2025-03-25 01:00:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02240576 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O6 |
|---|
| Molecular Mass | 314.079 |
|---|
| SMILES | CC(C(=O)O)c1ccc(C(=O)c2cccc(O)c2C(=O)O)cc1 |
|---|
| InChI Key | BHYAMEJROLMRQR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaromatic monoterpenoidsaryl ketonesaryl-phenylketonesbenzoic acidsbenzoyl derivativesdicarboxylic acids and derivativesdiphenylmethaneshydrocarbon derivativesmonocyclic monoterpenoidsorganic oxidesphenylpropanoic acidssalicylic acidsvinylogous acids |
|---|
| Substituents | diphenylmethanemonoterpenoidcarbonyl groupmonocyclic monoterpenoidcarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidp-cymenesalicylic acidcarboxylic acid derivativebenzophenoneketoneorganic oxide2-phenylpropanoic-acid1-carboxy-2-haloaromatic compoundbenzoic acidaryl-phenylketonebenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidhydroxybenzoic acidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compoundsalicylic acid or derivativesdicarboxylic acid or derivativesphenolhydrocarbon derivativeorganooxygen compoundaromatic monoterpenoidaryl ketone |
|---|