| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:17 UTC |
|---|
| Update Date | 2025-03-25 01:00:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02240747 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14N2O2 |
|---|
| Molecular Mass | 254.1055 |
|---|
| SMILES | CC(=O)Nc1cccc(C(=O)c2ccccc2)c1N |
|---|
| InChI Key | NXTLVOINMWFKJD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesamino acids and derivativesaryl ketonesaryl-phenylketonesbenzoyl derivativescarboxylic acids and derivativesdiphenylmethaneshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsprimary aminessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | diphenylmethanecarbonyl groupn-acetylarylamineamino acid or derivativesbenzoyln-arylamidecarboxylic acid derivativebenzophenoneketoneorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidevinylogous amideacetanilidearyl-phenylketonecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compoundaryl ketone |
|---|
