| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:17 UTC |
|---|
| Update Date | 2025-03-25 01:00:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02240773 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C25H42O6 |
|---|
| Molecular Mass | 438.2981 |
|---|
| SMILES | CC(=O)OCC1(C)CCCC2(C)C3C(O)CC4(C)C(CCC4(O)C(O)CO)C3CCC12 |
|---|
| InChI Key | GVGVALCDBPQGLL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | hydroxysteroids |
|---|
| Direct Parent | 21-hydroxysteroids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 11-hydroxysteroids17-hydroxysteroidscarbonyl compoundscarboxylic acid esterscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidespregnane steroidsprimary alcoholssecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcyclic alcoholcarboxylic acid derivativealiphatic homopolycyclic compoundtertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound21-hydroxysteroidcarboxylic acid estersecondary alcoholhydrocarbon derivative11-hydroxysteroidprimary alcoholpregnane-skeletonorganooxygen compound17-hydroxysteroid |
|---|