| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:21 UTC |
|---|
| Update Date | 2025-03-25 01:00:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02240922 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H28O14P2 |
|---|
| Molecular Mass | 482.0954 |
|---|
| SMILES | CC(C)(COP(=O)(O)OCC1OC(CO)C(O)C(O)C1CP(=O)(O)O)C(O)C(=O)O |
|---|
| InChI Key | ORPHQBQCWNTJNA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl ethersdialkyl phosphatesfatty acids and conjugateshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholsshort-chain hydroxy acids and derivatives |
|---|
| Substituents | carbonyl groupethercarboxylic acidshort-chain hydroxy acidalpha-hydroxy acidfatty acidcarboxylic acid derivativedialkyl etherorganic oxidealiphatic heteromonocyclic compoundorganopnictogen compoundorganophosphorus compoundoxaneprimary alcoholorganophosphonic acid derivativeorganoheterocyclic compoundalcoholhydroxy acidoxacycledialkyl phosphatemonocarboxylic acid or derivativesphosphoric acid estersecondary alcoholhexose phosphatehydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
